C13H16F3NO — CID 103854371
2-but-3-enoxy-N-[(3,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 103854371) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-but-3-enoxy-N-[(3,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | 2-but-3-enoxy-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103854371 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-but-3-enoxy-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | C=CCCOCCNCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H16F3NO/c1-2-3-5-18-6-4-17-9-10-7-11(14)13(16)12(15)8-10/h2,7-8,17H,1,3-6,9H2 |
| InChIKey | VIBBYRSLFSGWNQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|