C13H17F2NO — CID 103854452
2-but-3-enoxy-N-[(3,4-difluorophenyl)methyl]ethanamine (PubChem CID 103854452) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is 2-but-3-enoxy-N-[(3,4-difluorophenyl)methyl]ethanamine.
| Compound Name | 2-but-3-enoxy-N-[(3,4-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103854452 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-but-3-enoxy-N-[(3,4-difluorophenyl)methyl]ethanamine |
| SMILES | C=CCCOCCNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO/c1-2-3-7-17-8-6-16-10-11-4-5-12(14)13(15)9-11/h2,4-5,9,16H,1,3,6-8,10H2 |
| InChIKey | UTKZMIUXFWZTNO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|