C11H14N4O5 — CID 106401345
2,3-dimethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 106401345) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2,3-dimethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106401345 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2,3-dimethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C11H14N4O5/c1-6(7(2)10(17)18)9(16)14-11(19)12-4-3-8-13-5-20-15-8/h5H,3-4H2,1-2H3,(H,17,18)(H2,12,14,16,19) |
| InChIKey | UKYDSYWTWNCRTK-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|