C8H9N3O4 — CID 106394764
(E)-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 106394764) has the molecular formula C8H9N3O4 and a molecular weight of 211.18 g/mol. Its IUPAC name is (E)-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106394764 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (E)-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCCc1ncon1 |
| InChI | InChI=1S/C8H9N3O4/c12-7(1-2-8(13)14)9-4-3-6-10-5-15-11-6/h1-2,5H,3-4H2,(H,9,12)(H,13,14)/b2-1+ |
| InChIKey | HPHPDMDCQXFJBY-OWOJBTEDSA-N |
| XLogP | -0.63 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|