C7H9N3O3 — CID 106401837
(E)-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid (PubChem CID 106401837) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is (E)-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid.
| Compound Name | (E)-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 106401837 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | (E)-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid |
| SMILES | O=C(O)/C=C/CNCc1ncon1 |
| InChI | InChI=1S/C7H9N3O3/c11-7(12)2-1-3-8-4-6-9-5-13-10-6/h1-2,5,8H,3-4H2,(H,11,12)/b2-1+ |
| InChIKey | ZQDNQWKNGLJGNW-OWOJBTEDSA-N |
| XLogP | -0.20 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|