C7H9N3O2 — CID 106395515
(E)-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-enamide (PubChem CID 106395515) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is (E)-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-enamide.
| Compound Name | (E)-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 106395515 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (E)-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NCc1ncon1 |
| InChI | InChI=1S/C7H9N3O2/c1-2-3-7(11)8-4-6-9-5-12-10-6/h2-3,5H,4H2,1H3,(H,8,11)/b3-2+ |
| InChIKey | QSQWSPNZZXSIAM-NSCUHMNNSA-N |
| XLogP | 0.26 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|