C8H13N3O — CID 106398746
3-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-en-1-amine (PubChem CID 106398746) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-en-1-amine.
| Compound Name | 3-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-en-1-amine |
|---|---|
| PubChem CID | 106398746 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)but-2-en-1-amine |
| SMILES | CC(C)=CCNCc1ncon1 |
| InChI | InChI=1S/C8H13N3O/c1-7(2)3-4-9-5-8-10-6-12-11-8/h3,6,9H,4-5H2,1-2H3 |
| InChIKey | WUSZUXPHKHIDJL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|