C9H14N4O2 — CID 106397928
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-(prop-2-enylamino)acetamide (PubChem CID 106397928) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 106397928 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C9H14N4O2/c1-2-4-10-6-9(14)11-5-3-8-12-7-15-13-8/h2,7,10H,1,3-6H2,(H,11,14) |
| InChIKey | JJYYBXBDXMHDMK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|