C6H7N3O2 — CID 106395489
N-(1,2,4-oxadiazol-3-ylmethyl)prop-2-enamide (PubChem CID 106395489) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)prop-2-enamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 106395489 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCc1ncon1 |
| InChI | InChI=1S/C6H7N3O2/c1-2-6(10)7-3-5-8-4-11-9-5/h2,4H,1,3H2,(H,7,10) |
| InChIKey | BYGLTABSFZWUNR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|