C8H12N4O2 — CID 106397150
N-(1,2,4-oxadiazol-3-ylmethyl)-2-(prop-2-enylamino)acetamide (PubChem CID 106397150) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 106397150 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)NCc1ncon1 |
| InChI | InChI=1S/C8H12N4O2/c1-2-3-9-5-8(13)10-4-7-11-6-14-12-7/h2,6,9H,1,3-5H2,(H,10,13) |
| InChIKey | HSYRSFAFNGSRAA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|