C10H12N4O2 — CID 106398562
1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]pyridin-2-one (PubChem CID 106398562) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]pyridin-2-one.
| Compound Name | 1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 106398562 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCNCc1ncon1 |
| InChI | InChI=1S/C10H12N4O2/c15-10-3-1-2-5-14(10)6-4-11-7-9-12-8-16-13-9/h1-3,5,8,11H,4,6-7H2 |
| InChIKey | BITKGBZPOGIAEA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|