C7H7N3O4 — CID 106394637
(E)-4-(1,2,4-oxadiazol-3-ylmethylamino)-4-oxobut-2-enoic acid (PubChem CID 106394637) has the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. Its IUPAC name is (E)-4-(1,2,4-oxadiazol-3-ylmethylamino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(1,2,4-oxadiazol-3-ylmethylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106394637 |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | (E)-4-(1,2,4-oxadiazol-3-ylmethylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCc1ncon1 |
| InChI | InChI=1S/C7H7N3O4/c11-6(1-2-7(12)13)8-3-5-9-4-14-10-5/h1-2,4H,3H2,(H,8,11)(H,12,13)/b2-1+ |
| InChIKey | ROWYKWBYHMBLCG-OWOJBTEDSA-N |
| XLogP | -0.67 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|