C6H7N3O3 — CID 106401817
(E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoic acid (PubChem CID 106401817) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoic acid.
| Compound Name | (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 106401817 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/NCc1ncon1 |
| InChI | InChI=1S/C6H7N3O3/c10-6(11)1-2-7-3-5-8-4-12-9-5/h1-2,4,7H,3H2,(H,10,11)/b2-1+ |
| InChIKey | DUQNFGKKHWLYSZ-OWOJBTEDSA-N |
| XLogP | -0.24 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|