C7H9N3O3 — CID 106401759
methyl (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoate (PubChem CID 106401759) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is methyl (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoate.
| Compound Name | methyl (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 106401759 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | methyl (E)-3-(1,2,4-oxadiazol-3-ylmethylamino)prop-2-enoate |
| SMILES | COC(=O)/C=C/NCc1ncon1 |
| InChI | InChI=1S/C7H9N3O3/c1-12-7(11)2-3-8-4-6-9-5-13-10-6/h2-3,5,8H,4H2,1H3/b3-2+ |
| InChIKey | OWFRRGRUHFHQFD-NSCUHMNNSA-N |
| XLogP | -0.15 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|