C8H11N3O3 — CID 106402022
methyl (E)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]prop-2-enoate (PubChem CID 106402022) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl (E)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]prop-2-enoate |
|---|---|
| PubChem CID | 106402022 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | methyl (E)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCCc1ncon1 |
| InChI | InChI=1S/C8H11N3O3/c1-13-8(12)3-5-9-4-2-7-10-6-14-11-7/h3,5-6,9H,2,4H2,1H3/b5-3+ |
| InChIKey | PBPZTSDBPOTKTL-HWKANZROSA-N |
| XLogP | -0.11 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|