3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid

C8H11N3O3 — CID 106401851

IUPAC3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid
SMILESCC(=CC(=O)O)CNCc1ncon1
InChIInChI=1S/C8H11N3O3/c1-6(2-8(12)13)3-9-4-7-10-5-14-11-7/h2,5,9H,3-4H2,1H3,(H,12,13)
InChIKeyXDKVCWJHUTZGQB-UHFFFAOYSA-N
MW197.19 g/mol
LogP0.19
Rot. Bonds5

About 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid

3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid (PubChem CID 106401851) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid.

Molecular Properties

Compound Name3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid
PubChem CID106401851
Molecular FormulaC8H11N3O3
Molecular Weight197.19 g/mol
Exact Mass197.08
IUPAC Name3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid
SMILESCC(=CC(=O)O)CNCc1ncon1
InChIInChI=1S/C8H11N3O3/c1-6(2-8(12)13)3-9-4-7-10-5-14-11-7/h2,5,9H,3-4H2,1H3,(H,12,13)
InChIKeyXDKVCWJHUTZGQB-UHFFFAOYSA-N
XLogP0.19
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.19
LogP ≤ 50.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid?
The IUPAC name of 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid (CID 106401851) is 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid.
What is the SMILES notation for 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid?
The canonical SMILES for 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid is CC(=CC(=O)O)CNCc1ncon1.
What is the InChIKey of 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid?
The InChIKey is XDKVCWJHUTZGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-6(2-8(12)13)3-9-4-7-10-5-14-11-7/h2,5,9H,3-4H2,1H3,(H,12,13).
What are the key properties of 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid?
3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid has a molecular weight of 197.19 g/mol, XLogP of 0.19, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoic acid is sourced from PubChem (CID 106401851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).