C9H13N3O3 — CID 106401784
methyl 2-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate (PubChem CID 106401784) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 2-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate.
| Compound Name | methyl 2-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate |
|---|---|
| PubChem CID | 106401784 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | methyl 2-methyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate |
| SMILES | COC(=O)C(C)=CCNCc1ncon1 |
| InChI | InChI=1S/C9H13N3O3/c1-7(9(13)14-2)3-4-10-5-8-11-6-15-12-8/h3,6,10H,4-5H2,1-2H3 |
| InChIKey | FQGFDGJCJQRTMY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|