C7H11N3O — CID 106398717
N-(1,2,4-oxadiazol-3-ylmethyl)but-3-en-2-amine (PubChem CID 106398717) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)but-3-en-2-amine.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 106398717 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)but-3-en-2-amine |
| SMILES | C=CC(C)NCc1ncon1 |
| InChI | InChI=1S/C7H11N3O/c1-3-6(2)8-4-7-9-5-11-10-7/h3,5-6,8H,1,4H2,2H3 |
| InChIKey | YEUFLUQPWNFIIK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|