About 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine
2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine (PubChem CID 106393664) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine.
Analyze 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine?
The IUPAC name of 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine (CID 106393664) is 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine.
What is the SMILES notation for 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine?
The canonical SMILES for 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine is CC(CN)NCc1ncon1.
What is the InChIKey of 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine?
The InChIKey is UYGUTMQSBPIJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-5(2-7)8-3-6-9-4-11-10-6/h4-5,8H,2-3,7H2,1H3.
What are the key properties of 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine?
2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine has a molecular weight of 156.19 g/mol, XLogP of -0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(1,2,4-oxadiazol-3-ylmethyl)propane-1,2-diamine is sourced from PubChem (CID 106393664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).