C6H9N3O — CID 62390074
3-pyrrolidin-2-yl-1,2,4-oxadiazole (PubChem CID 62390074) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is 3-pyrrolidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-pyrrolidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 62390074 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 3-pyrrolidin-2-yl-1,2,4-oxadiazole |
| SMILES | c1nc(C2CCCN2)no1 |
| InChI | InChI=1S/C6H9N3O/c1-2-5(7-3-1)6-8-4-10-9-6/h4-5,7H,1-3H2 |
| InChIKey | ATFSESSLTKRXKN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |