C10H17N3O2 — CID 106402025
2-but-3-enoxy-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]ethanamine (PubChem CID 106402025) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-but-3-enoxy-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]ethanamine.
| Compound Name | 2-but-3-enoxy-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106402025 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-but-3-enoxy-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]ethanamine |
| SMILES | C=CCCOCCNCc1nonc1C |
| InChI | InChI=1S/C10H17N3O2/c1-3-4-6-14-7-5-11-8-10-9(2)12-15-13-10/h3,11H,1,4-8H2,2H3 |
| InChIKey | SJWYHXZAMMFEEV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|