C8H7N5O3 — CID 106402960
4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine (PubChem CID 106402960) has the molecular formula C8H7N5O3 and a molecular weight of 221.18 g/mol. Its IUPAC name is 4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine.
| Compound Name | 4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106402960 |
| Molecular Formula | C8H7N5O3 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccnc(NCc2ncon2)c1 |
| InChI | InChI=1S/C8H7N5O3/c14-13(15)6-1-2-9-7(3-6)10-4-8-11-5-16-12-8/h1-3,5H,4H2,(H,9,10) |
| InChIKey | PRQQMBLHMWWQAS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|