C11H12N4O3 — CID 114180511
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-nitropyridin-2-amine (PubChem CID 114180511) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-nitropyridin-2-amine.
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-nitropyridin-2-amine |
|---|---|
| PubChem CID | 114180511 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-nitropyridin-2-amine |
| SMILES | CCc1cnc(CNc2cc([N+](=O)[O-])ccn2)o1 |
| InChI | InChI=1S/C11H12N4O3/c1-2-9-6-14-11(18-9)7-13-10-5-8(15(16)17)3-4-12-10/h3-6H,2,7H2,1H3,(H,12,13) |
| InChIKey | DWTVDBBIJBIRSI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|