C12H11Cl2N3O3 — CID 106373420
4,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline (PubChem CID 106373420) has the molecular formula C12H11Cl2N3O3 and a molecular weight of 316.14 g/mol. Its IUPAC name is 4,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline.
| Compound Name | 4,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 106373420 |
| Molecular Formula | C12H11Cl2N3O3 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4,5-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline |
| SMILES | CCc1cnc(CNc2cc(Cl)c(Cl)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H11Cl2N3O3/c1-2-7-5-16-12(20-7)6-15-10-3-8(13)9(14)4-11(10)17(18)19/h3-5,15H,2,6H2,1H3 |
| InChIKey | MZBMVONELHTSPJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|