C9H11N5O — CID 106403520
6-ethyl-N-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-4-amine (PubChem CID 106403520) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 6-ethyl-N-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106403520 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 6-ethyl-N-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-4-amine |
| SMILES | CCc1cc(NCc2ncon2)ncn1 |
| InChI | InChI=1S/C9H11N5O/c1-2-7-3-8(12-5-11-7)10-4-9-13-6-15-14-9/h3,5-6H,2,4H2,1H3,(H,10,11,12) |
| InChIKey | JGIUNXZZLCTIQT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |