C10H12N4O2 — CID 106403626
6-ethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine (PubChem CID 106403626) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 6-ethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine.
| Compound Name | 6-ethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106403626 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 6-ethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine |
| SMILES | CCOc1cccc(NCc2ncon2)n1 |
| InChI | InChI=1S/C10H12N4O2/c1-2-15-10-5-3-4-8(13-10)11-6-9-12-7-16-14-9/h3-5,7H,2,6H2,1H3,(H,11,13) |
| InChIKey | FVANIAPIZAQJKQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |