C9H10N4O2 — CID 106403349
6-methoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine (PubChem CID 106403349) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 6-methoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine.
| Compound Name | 6-methoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106403349 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 6-methoxy-N-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-amine |
| SMILES | COc1cccc(NCc2ncon2)n1 |
| InChI | InChI=1S/C9H10N4O2/c1-14-9-4-2-3-7(12-9)10-5-8-11-6-15-13-8/h2-4,6H,5H2,1H3,(H,10,12) |
| InChIKey | PTDAJBHKPIOKNM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |