C12H14N2OS — CID 63590573
6-ethoxy-N-(thiophen-2-ylmethyl)pyridin-2-amine (PubChem CID 63590573) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 6-ethoxy-N-(thiophen-2-ylmethyl)pyridin-2-amine.
| Compound Name | 6-ethoxy-N-(thiophen-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63590573 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 6-ethoxy-N-(thiophen-2-ylmethyl)pyridin-2-amine |
| SMILES | CCOc1cccc(NCc2cccs2)n1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-15-12-7-3-6-11(14-12)13-9-10-5-4-8-16-10/h3-8H,2,9H2,1H3,(H,13,14) |
| InChIKey | UKKZSHVOPSAXID-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |