About 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine
6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine (PubChem CID 106405527) has the molecular formula C11H14BrN5O
and a molecular weight of 312.17 g/mol. Its IUPAC name is 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine |
| PubChem CID | 106405527 |
| Molecular Formula | C11H14BrN5O |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(Br)cc(NCCc2ncno2)n1 |
| InChI | InChI=1S/C11H14BrN5O/c1-7(2)11-16-8(12)5-9(17-11)13-4-3-10-14-6-15-18-10/h5-7H,3-4H2,1-2H3,(H,13,16,17) |
| InChIKey | JFBPELRGOJSBHU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine?
The IUPAC name of 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine (CID 106405527) is 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine.
What is the SMILES notation for 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine?
The canonical SMILES for 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine is CC(C)c1nc(Br)cc(NCCc2ncno2)n1.
What is the InChIKey of 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine?
The InChIKey is JFBPELRGOJSBHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN5O/c1-7(2)11-16-8(12)5-9(17-11)13-4-3-10-14-6-15-18-10/h5-7H,3-4H2,1-2H3,(H,13,16,17).
What are the key properties of 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine?
6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine has a molecular weight of 312.17 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine is sourced from PubChem (CID 106405527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).