C13H12N4O3 — CID 106406611
3-(4-hydroxybut-1-ynyl)-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-4-carboxamide (PubChem CID 106406611) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106406611 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCc1ncon1)c1ccncc1C#CCCO |
| InChI | InChI=1S/C13H12N4O3/c18-6-2-1-3-10-7-14-5-4-11(10)13(19)15-8-12-16-9-20-17-12/h4-5,7,9,18H,2,6,8H2,(H,15,19) |
| InChIKey | FATOETUPBNGUEA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|