C13H16N2O4S — CID 66483043
3-(4-hydroxybut-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide (PubChem CID 66483043) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66483043 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)CCNC(=O)c1ccncc1C#CCCO |
| InChI | InChI=1S/C13H16N2O4S/c1-20(18,19)9-7-15-13(17)12-5-6-14-10-11(12)4-2-3-8-16/h5-6,10,16H,3,7-9H2,1H3,(H,15,17) |
| InChIKey | LJPOZHZIYTXJHF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|