C12H15N3O3S — CID 66484649
3-(3-aminoprop-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide (PubChem CID 66484649) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66484649 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(2-methylsulfonylethyl)pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)CCNC(=O)c1ccncc1C#CCN |
| InChI | InChI=1S/C12H15N3O3S/c1-19(17,18)8-7-15-12(16)11-4-6-14-9-10(11)3-2-5-13/h4,6,9H,5,7-8,13H2,1H3,(H,15,16) |
| InChIKey | QCMMHXOQDGYPRL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|