C12H14N4O3 — CID 83203212
2-[[3-(3-aminoprop-1-ynyl)pyridine-4-carbonyl]amino]ethyl carbamate (PubChem CID 83203212) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[[3-(3-aminoprop-1-ynyl)pyridine-4-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[3-(3-aminoprop-1-ynyl)pyridine-4-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203212 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-[[3-(3-aminoprop-1-ynyl)pyridine-4-carbonyl]amino]ethyl carbamate |
| SMILES | NCC#Cc1cnccc1C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C12H14N4O3/c13-4-1-2-9-8-15-5-3-10(9)11(17)16-6-7-19-12(14)18/h3,5,8H,4,6-7,13H2,(H2,14,18)(H,16,17) |
| InChIKey | OJDYLWONQONCPW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|