C13H14FN3O3 — CID 83203785
2-[[2-(3-aminoprop-1-ynyl)-5-fluorobenzoyl]amino]ethyl carbamate (PubChem CID 83203785) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[[2-(3-aminoprop-1-ynyl)-5-fluorobenzoyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-(3-aminoprop-1-ynyl)-5-fluorobenzoyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203785 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[[2-(3-aminoprop-1-ynyl)-5-fluorobenzoyl]amino]ethyl carbamate |
| SMILES | NCC#Cc1ccc(F)cc1C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C13H14FN3O3/c14-10-4-3-9(2-1-5-15)11(8-10)12(18)17-6-7-20-13(16)19/h3-4,8H,5-7,15H2,(H2,16,19)(H,17,18) |
| InChIKey | PVCZXHDJAALRQN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|