C13H16FN3O3S — CID 60822004
2-(3-aminoprop-1-ynyl)-5-fluoro-N-[2-(methanesulfonamido)ethyl]benzamide (PubChem CID 60822004) has the molecular formula C13H16FN3O3S and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-5-fluoro-N-[2-(methanesulfonamido)ethyl]benzamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-5-fluoro-N-[2-(methanesulfonamido)ethyl]benzamide |
|---|---|
| PubChem CID | 60822004 |
| Molecular Formula | C13H16FN3O3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-5-fluoro-N-[2-(methanesulfonamido)ethyl]benzamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1cc(F)ccc1C#CCN |
| InChI | InChI=1S/C13H16FN3O3S/c1-21(19,20)17-8-7-16-13(18)12-9-11(14)5-4-10(12)3-2-6-15/h4-5,9,17H,6-8,15H2,1H3,(H,16,18) |
| InChIKey | CZGODKMZLOCQGP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|