C11H10ClN5O — CID 106406965
3-[[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]-1,2,4-oxadiazole (PubChem CID 106406965) has the molecular formula C11H10ClN5O and a molecular weight of 263.69 g/mol. Its IUPAC name is 3-[[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106406965 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-[[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc2nc(CCl)n(Cc3ncon3)c2n1 |
| InChI | InChI=1S/C11H10ClN5O/c1-7-2-3-8-11(14-7)17(10(4-12)15-8)5-9-13-6-18-16-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | CLVXABXNXVNEDF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|