C12H10ClFN4O — CID 106407030
3-[[2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 106407030) has the molecular formula C12H10ClFN4O and a molecular weight of 280.69 g/mol. Its IUPAC name is 3-[[2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[[2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106407030 |
| Molecular Formula | C12H10ClFN4O |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-[[2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1nc2ccc(F)cc2n1Cc1ncon1 |
| InChI | InChI=1S/C12H10ClFN4O/c1-7(13)12-16-9-3-2-8(14)4-10(9)18(12)5-11-15-6-19-17-11/h2-4,6-7H,5H2,1H3 |
| InChIKey | APGYILQPWZRRQT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|