C12H9ClF2N4O — CID 106406915
3-[[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 106406915) has the molecular formula C12H9ClF2N4O and a molecular weight of 298.68 g/mol. Its IUPAC name is 3-[[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106406915 |
| Molecular Formula | C12H9ClF2N4O |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-[[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1nc2ccc(F)c(F)c2n1Cc1ncon1 |
| InChI | InChI=1S/C12H9ClF2N4O/c1-6(13)12-17-8-3-2-7(14)10(15)11(8)19(12)4-9-16-5-20-18-9/h2-3,5-6H,4H2,1H3 |
| InChIKey | NDLJZNIHTSVPRL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|