About 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole
2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole (PubChem CID 104763347) has the molecular formula C14H17ClF2N2O
and a molecular weight of 302.75 g/mol. Its IUPAC name is 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole |
| PubChem CID | 104763347 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole |
| SMILES | CC(C)OCCn1c(C(C)Cl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C14H17ClF2N2O/c1-8(2)20-7-6-19-13-11(18-14(19)9(3)15)5-4-10(16)12(13)17/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | QLXBOQNKEMOWCP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole?
The IUPAC name of 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole (CID 104763347) is 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole.
What is the SMILES notation for 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole?
The canonical SMILES for 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole is CC(C)OCCn1c(C(C)Cl)nc2ccc(F)c(F)c21.
What is the InChIKey of 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole?
The InChIKey is QLXBOQNKEMOWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClF2N2O/c1-8(2)20-7-6-19-13-11(18-14(19)9(3)15)5-4-10(16)12(13)17/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole?
2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole has a molecular weight of 302.75 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-6,7-difluoro-1-(2-propan-2-yloxyethyl)benzimidazole is sourced from PubChem (CID 104763347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).