C14H15ClF2N2O2 — CID 62535237
ethyl 3-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]propanoate (PubChem CID 62535237) has the molecular formula C14H15ClF2N2O2 and a molecular weight of 316.74 g/mol. Its IUPAC name is ethyl 3-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]propanoate.
| Compound Name | ethyl 3-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 62535237 |
| Molecular Formula | C14H15ClF2N2O2 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | ethyl 3-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]propanoate |
| SMILES | CCOC(=O)CCn1c(C(C)Cl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C14H15ClF2N2O2/c1-3-21-11(20)6-7-19-13-10(18-14(19)8(2)15)5-4-9(16)12(13)17/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | NCTSIXHAZNWFIO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|