C14H18ClF2N3 — CID 62532231
1-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]-N,N-dimethylpropan-2-amine (PubChem CID 62532231) has the molecular formula C14H18ClF2N3 and a molecular weight of 301.77 g/mol. Its IUPAC name is 1-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]-N,N-dimethylpropan-2-amine.
| Compound Name | 1-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 62532231 |
| Molecular Formula | C14H18ClF2N3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[2-(1-chloroethyl)-6,7-difluorobenzimidazol-1-yl]-N,N-dimethylpropan-2-amine |
| SMILES | CC(Cl)c1nc2ccc(F)c(F)c2n1CC(C)N(C)C |
| InChI | InChI=1S/C14H18ClF2N3/c1-8(19(3)4)7-20-13-11(18-14(20)9(2)15)6-5-10(16)12(13)17/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | HKJFRDQTDMBNDM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|