C14H15N5O — CID 106408059
2-cyclopropyl-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-5-amine (PubChem CID 106408059) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-cyclopropyl-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-5-amine.
| Compound Name | 2-cyclopropyl-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 106408059 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-cyclopropyl-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C1CC1)n2CCc1ncon1 |
| InChI | InChI=1S/C14H15N5O/c15-10-3-4-12-11(7-10)17-14(9-1-2-9)19(12)6-5-13-16-8-20-18-13/h3-4,7-9H,1-2,5-6,15H2 |
| InChIKey | CZADDHUKXKTSAS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|