C15H20N2O7 — CID 10640873
tert-butyl (2E)-2-[(2R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-ylidene]acetate (PubChem CID 10640873) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is tert-butyl (2E)-2-[(2R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-ylidene]acetate.
| Compound Name | tert-butyl (2E)-2-[(2R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-ylidene]acetate |
|---|---|
| PubChem CID | 10640873 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | tert-butyl (2E)-2-[(2R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-ylidene]acetate |
| SMILES | CC(C)(C)OC(=O)/C=C1/[C@H](n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C15H20N2O7/c1-15(2,3)24-11(20)6-8-12(21)9(7-18)23-13(8)17-5-4-10(19)16-14(17)22/h4-6,9,12-13,18,21H,7H2,1-3H3,(H,16,19,22)/b8-6+/t9-,12+,13-/m1/s1 |
| InChIKey | ICKLHVPCECUTNU-DLLCJJIQSA-N |
| XLogP | -0.94 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|