C21H28O2Si — CID 10640932
[1-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-trimethylsilylbuta-1,2-dienyl] acetate (PubChem CID 10640932) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is [1-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-trimethylsilylbuta-1,2-dienyl] acetate.
| Compound Name | [1-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-trimethylsilylbuta-1,2-dienyl] acetate |
|---|---|
| PubChem CID | 10640932 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [1-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-trimethylsilylbuta-1,2-dienyl] acetate |
| SMILES | CC(=O)OC(=C=C(C)[Si](C)(C)C)c1ccccc1C#CC(C)(C)C |
| InChI | InChI=1S/C21H28O2Si/c1-16(24(6,7)8)15-20(23-17(2)22)19-12-10-9-11-18(19)13-14-21(3,4)5/h9-12H,1-8H3 |
| InChIKey | QQGFBZMQQFQTFZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|