C12H16N6O3 — CID 106412297
3-nitro-2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyridine-2,6-diamine (PubChem CID 106412297) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-nitro-2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyridine-2,6-diamine.
| Compound Name | 3-nitro-2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 106412297 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-nitro-2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1ccc([N+](=O)[O-])c(NCCc2ncon2)n1 |
| InChI | InChI=1S/C12H16N6O3/c1-2-6-13-10-4-3-9(18(19)20)12(16-10)14-7-5-11-15-8-21-17-11/h3-4,8H,2,5-7H2,1H3,(H2,13,14,16) |
| InChIKey | LFHMGBTXEPZIGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|