C11H15N7O3 — CID 106412327
5-nitro-4-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyrimidine-4,6-diamine (PubChem CID 106412327) has the molecular formula C11H15N7O3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-nitro-4-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106412327 |
| Molecular Formula | C11H15N7O3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-nitro-4-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(NCCc2ncon2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N7O3/c1-2-4-12-10-9(18(19)20)11(15-6-14-10)13-5-3-8-16-7-21-17-8/h6-7H,2-5H2,1H3,(H2,12,13,14,15) |
| InChIKey | UJTKFKJCXYUNDU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|