C11H16N6O3 — CID 106404584
3-methyl-4-nitro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-propylpyrazol-5-amine (PubChem CID 106404584) has the molecular formula C11H16N6O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-methyl-4-nitro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-propylpyrazol-5-amine.
| Compound Name | 3-methyl-4-nitro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-propylpyrazol-5-amine |
|---|---|
| PubChem CID | 106404584 |
| Molecular Formula | C11H16N6O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-methyl-4-nitro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-propylpyrazol-5-amine |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NCCc1ncon1 |
| InChI | InChI=1S/C11H16N6O3/c1-3-6-16-11(10(17(18)19)8(2)14-16)12-5-4-9-13-7-20-15-9/h7,12H,3-6H2,1-2H3 |
| InChIKey | SSJYQIGTNSRQSQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|