C12H19N7O2 — CID 66028582
3-methyl-4-nitro-1-propyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazol-5-amine (PubChem CID 66028582) has the molecular formula C12H19N7O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 3-methyl-4-nitro-1-propyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazol-5-amine.
| Compound Name | 3-methyl-4-nitro-1-propyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 66028582 |
| Molecular Formula | C12H19N7O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-methyl-4-nitro-1-propyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazol-5-amine |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H19N7O2/c1-3-7-18-12(11(19(20)21)9(2)17-18)13-6-4-5-10-14-8-15-16-10/h8,13H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | SHWITETUTVEBJD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|