C11H19N7 — CID 66012088
1-ethyl-3-methyl-5-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazole-4,5-diamine (PubChem CID 66012088) has the molecular formula C11H19N7 and a molecular weight of 249.32 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazole-4,5-diamine.
| Compound Name | 1-ethyl-3-methyl-5-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66012088 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-ethyl-3-methyl-5-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazole-4,5-diamine |
| SMILES | CCn1nc(C)c(N)c1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H19N7/c1-3-18-11(10(12)8(2)17-18)13-6-4-5-9-14-7-15-16-9/h7,13H,3-6,12H2,1-2H3,(H,14,15,16) |
| InChIKey | QTWKXZBXAWYOFI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|