C12H24N4 — CID 66012859
1-ethyl-3-methyl-5-N-(4-methylpentyl)pyrazole-4,5-diamine (PubChem CID 66012859) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-N-(4-methylpentyl)pyrazole-4,5-diamine.
| Compound Name | 1-ethyl-3-methyl-5-N-(4-methylpentyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66012859 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-ethyl-3-methyl-5-N-(4-methylpentyl)pyrazole-4,5-diamine |
| SMILES | CCn1nc(C)c(N)c1NCCCC(C)C |
| InChI | InChI=1S/C12H24N4/c1-5-16-12(11(13)10(4)15-16)14-8-6-7-9(2)3/h9,14H,5-8,13H2,1-4H3 |
| InChIKey | CDNPXHITRAWNCC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|